C15H25NO2 — CID 174821612
butyl 2-methylprop-2-enoate;2-methylprop-1-ene;prop-2-enenitrile (PubChem CID 174821612) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is butyl 2-methylprop-2-enoate;2-methylprop-1-ene;prop-2-enenitrile.
| Compound Name | butyl 2-methylprop-2-enoate;2-methylprop-1-ene;prop-2-enenitrile |
|---|---|
| PubChem CID | 174821612 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | butyl 2-methylprop-2-enoate;2-methylprop-1-ene;prop-2-enenitrile |
| SMILES | C=C(C)C.C=C(C)C(=O)OCCCC.C=CC#N |
| InChI | InChI=1S/C8H14O2.C4H8.C3H3N/c1-4-5-6-10-8(9)7(2)3;1-4(2)3;1-2-3-4/h2,4-6H2,1,3H3;1H2,2-3H3;2H,1H2 |
| InChIKey | JTNFGRZHQATDAC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|