C9H21NO6S — CID 174612493
azane;2-hydroxyethyl 2-methylprop-2-enoate;propane-1-sulfonic acid (PubChem CID 174612493) has the molecular formula C9H21NO6S and a molecular weight of 271.33 g/mol. Its IUPAC name is azane;2-hydroxyethyl 2-methylprop-2-enoate;propane-1-sulfonic acid.
| Compound Name | azane;2-hydroxyethyl 2-methylprop-2-enoate;propane-1-sulfonic acid |
|---|---|
| PubChem CID | 174612493 |
| Molecular Formula | C9H21NO6S |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | azane;2-hydroxyethyl 2-methylprop-2-enoate;propane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)OCCO.CCCS(=O)(=O)O.N |
| InChI | InChI=1S/C6H10O3.C3H8O3S.H3N/c1-5(2)6(8)9-4-3-7;1-2-3-7(4,5)6;/h7H,1,3-4H2,2H3;2-3H2,1H3,(H,4,5,6);1H3 |
| InChIKey | TZWZBZYRRMENKA-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 135.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|