C10H18O7S — CID 122611081
2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethanesulfonic acid (PubChem CID 122611081) has the molecular formula C10H18O7S and a molecular weight of 282.31 g/mol. Its IUPAC name is 2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethanesulfonic acid.
| Compound Name | 2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 122611081 |
| Molecular Formula | C10H18O7S |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]ethanesulfonic acid |
| SMILES | C=C(C)C(=O)OCCOCCOCCS(=O)(=O)O |
| InChI | InChI=1S/C10H18O7S/c1-9(2)10(11)17-6-5-15-3-4-16-7-8-18(12,13)14/h1,3-8H2,2H3,(H,12,13,14) |
| InChIKey | PNZAVHMEABEPRD-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|