C9H16O3S — CID 89112339
2-(3-sulfanylpropoxy)ethyl 2-methylprop-2-enoate (PubChem CID 89112339) has the molecular formula C9H16O3S and a molecular weight of 204.29 g/mol. Its IUPAC name is 2-(3-sulfanylpropoxy)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(3-sulfanylpropoxy)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89112339 |
| Molecular Formula | C9H16O3S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 2-(3-sulfanylpropoxy)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCCS |
| InChI | InChI=1S/C9H16O3S/c1-8(2)9(10)12-6-5-11-4-3-7-13/h13H,1,3-7H2,2H3 |
| InChIKey | WKXRCZQBNVJHPH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|