About sulfane;3-sulfanylpropyl 2-methylprop-2-enoate
sulfane;3-sulfanylpropyl 2-methylprop-2-enoate (PubChem CID 175403752) has the molecular formula C7H14O2S2
and a molecular weight of 194.32 g/mol. Its IUPAC name is sulfane;3-sulfanylpropyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | sulfane;3-sulfanylpropyl 2-methylprop-2-enoate |
| PubChem CID | 175403752 |
| Molecular Formula | C7H14O2S2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | sulfane;3-sulfanylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCS.S |
| InChI | InChI=1S/C7H12O2S.H2S/c1-6(2)7(8)9-4-3-5-10;/h10H,1,3-5H2,2H3;1H2 |
| InChIKey | JBTLOYRRGSJPJG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze sulfane;3-sulfanylpropyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfane;3-sulfanylpropyl 2-methylprop-2-enoate?
The IUPAC name of sulfane;3-sulfanylpropyl 2-methylprop-2-enoate (CID 175403752) is sulfane;3-sulfanylpropyl 2-methylprop-2-enoate.
What is the SMILES notation for sulfane;3-sulfanylpropyl 2-methylprop-2-enoate?
The canonical SMILES for sulfane;3-sulfanylpropyl 2-methylprop-2-enoate is C=C(C)C(=O)OCCCS.S.
What is the InChIKey of sulfane;3-sulfanylpropyl 2-methylprop-2-enoate?
The InChIKey is JBTLOYRRGSJPJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2S.H2S/c1-6(2)7(8)9-4-3-5-10;/h10H,1,3-5H2,2H3;1H2.
What are the key properties of sulfane;3-sulfanylpropyl 2-methylprop-2-enoate?
sulfane;3-sulfanylpropyl 2-methylprop-2-enoate has a molecular weight of 194.32 g/mol, XLogP of 1.54, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sulfane;3-sulfanylpropyl 2-methylprop-2-enoate is sourced from PubChem (CID 175403752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).