C18H27O6P — CID 141098412
2-[bis[2-(2-methylprop-2-enoyloxy)ethyl]phosphanyl]ethyl 2-methylprop-2-enoate (PubChem CID 141098412) has the molecular formula C18H27O6P and a molecular weight of 370.38 g/mol. Its IUPAC name is 2-[bis[2-(2-methylprop-2-enoyloxy)ethyl]phosphanyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[bis[2-(2-methylprop-2-enoyloxy)ethyl]phosphanyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 141098412 |
| Molecular Formula | C18H27O6P |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2-[bis[2-(2-methylprop-2-enoyloxy)ethyl]phosphanyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCP(CCOC(=O)C(=C)C)CCOC(=O)C(=C)C |
| InChI | InChI=1S/C18H27O6P/c1-13(2)16(19)22-7-10-25(11-8-23-17(20)14(3)4)12-9-24-18(21)15(5)6/h1,3,5,7-12H2,2,4,6H3 |
| InChIKey | DOQLMHPLCNFHLG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|