C6H11KO5S — CID 173327634
potassium;hydride;2-(2-methylprop-2-enoyloxy)ethanesulfonic acid (PubChem CID 173327634) has the molecular formula C6H11KO5S and a molecular weight of 234.31 g/mol. Its IUPAC name is potassium;hydride;2-(2-methylprop-2-enoyloxy)ethanesulfonic acid.
| Compound Name | potassium;hydride;2-(2-methylprop-2-enoyloxy)ethanesulfonic acid |
|---|---|
| PubChem CID | 173327634 |
| Molecular Formula | C6H11KO5S |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | potassium;hydride;2-(2-methylprop-2-enoyloxy)ethanesulfonic acid |
| SMILES | C=C(C)C(=O)OCCS(=O)(=O)O.[H-].[K+] |
| InChI | InChI=1S/C6H10O5S.K.H/c1-5(2)6(7)11-3-4-12(8,9)10;;/h1,3-4H2,2H3,(H,8,9,10);;/q;+1;-1 |
| InChIKey | QGTHPGNLWQKCDT-UHFFFAOYSA-N |
| XLogP | -2.89 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|