C13H20O9S — CID 163742520
methyl prop-2-enoate;2-(2-methylprop-2-enoyloxy)ethanesulfonic acid;prop-2-enoic acid (PubChem CID 163742520) has the molecular formula C13H20O9S and a molecular weight of 352.36 g/mol. Its IUPAC name is methyl prop-2-enoate;2-(2-methylprop-2-enoyloxy)ethanesulfonic acid;prop-2-enoic acid.
| Compound Name | methyl prop-2-enoate;2-(2-methylprop-2-enoyloxy)ethanesulfonic acid;prop-2-enoic acid |
|---|---|
| PubChem CID | 163742520 |
| Molecular Formula | C13H20O9S |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | methyl prop-2-enoate;2-(2-methylprop-2-enoyloxy)ethanesulfonic acid;prop-2-enoic acid |
| SMILES | C=C(C)C(=O)OCCS(=O)(=O)O.C=CC(=O)O.C=CC(=O)OC |
| InChI | InChI=1S/C6H10O5S.C4H6O2.C3H4O2/c1-5(2)6(7)11-3-4-12(8,9)10;1-3-4(5)6-2;1-2-3(4)5/h1,3-4H2,2H3,(H,8,9,10);3H,1H2,2H3;2H,1H2,(H,4,5) |
| InChIKey | LJADMMBABDOBRB-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|