C13H23NO9S2 — CID 87135022
2-(2-methylprop-2-enoyloxy)ethanesulfonic acid;1-(prop-2-enoylamino)butane-1-sulfonic acid (PubChem CID 87135022) has the molecular formula C13H23NO9S2 and a molecular weight of 401.46 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethanesulfonic acid;1-(prop-2-enoylamino)butane-1-sulfonic acid.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethanesulfonic acid;1-(prop-2-enoylamino)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 87135022 |
| Molecular Formula | C13H23NO9S2 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethanesulfonic acid;1-(prop-2-enoylamino)butane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)OCCS(=O)(=O)O.C=CC(=O)NC(CCC)S(=O)(=O)O |
| InChI | InChI=1S/C7H13NO4S.C6H10O5S/c1-3-5-7(13(10,11)12)8-6(9)4-2;1-5(2)6(7)11-3-4-12(8,9)10/h4,7H,2-3,5H2,1H3,(H,8,9)(H,10,11,12);1,3-4H2,2H3,(H,8,9,10) |
| InChIKey | WTRHLERPBBQKEY-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 164.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|