C18H36NO5S+ — CID 134346440
dibutyl-[3-(2-methylprop-2-enoyloxy)propyl]-(3-sulfopropyl)azanium (PubChem CID 134346440) has the molecular formula C18H36NO5S+ and a molecular weight of 378.56 g/mol. Its IUPAC name is dibutyl-[3-(2-methylprop-2-enoyloxy)propyl]-(3-sulfopropyl)azanium.
| Compound Name | dibutyl-[3-(2-methylprop-2-enoyloxy)propyl]-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 134346440 |
| Molecular Formula | C18H36NO5S+ |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | dibutyl-[3-(2-methylprop-2-enoyloxy)propyl]-(3-sulfopropyl)azanium |
| SMILES | C=C(C)C(=O)OCCC[N+](CCCC)(CCCC)CCCS(=O)(=O)O |
| InChI | InChI=1S/C18H35NO5S/c1-5-7-11-19(12-8-6-2,14-10-16-25(21,22)23)13-9-15-24-18(20)17(3)4/h3,5-16H2,1-2,4H3/p+1 |
| InChIKey | GJNMCFWVBUKWGC-UHFFFAOYSA-O |
| XLogP | 3.19 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|