C6H12O6S — CID 139744922
2-(2-methylprop-2-enoyloxy)ethanesulfonic acid;hydrate (PubChem CID 139744922) has the molecular formula C6H12O6S and a molecular weight of 212.22 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethanesulfonic acid;hydrate.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethanesulfonic acid;hydrate |
|---|---|
| PubChem CID | 139744922 |
| Molecular Formula | C6H12O6S |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethanesulfonic acid;hydrate |
| SMILES | C=C(C)C(=O)OCCS(=O)(=O)O.O |
| InChI | InChI=1S/C6H10O5S.H2O/c1-5(2)6(7)11-3-4-12(8,9)10;/h1,3-4H2,2H3,(H,8,9,10);1H2 |
| InChIKey | DNLJJGCFQYTRRH-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 112.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|