C6H13NO6S — CID 53470662
hydrogen sulfate;2-(2-methylprop-2-enoyloxy)ethylazanium (PubChem CID 53470662) has the molecular formula C6H13NO6S and a molecular weight of 227.24 g/mol. Its IUPAC name is hydrogen sulfate;2-(2-methylprop-2-enoyloxy)ethylazanium.
| Compound Name | hydrogen sulfate;2-(2-methylprop-2-enoyloxy)ethylazanium |
|---|---|
| PubChem CID | 53470662 |
| Molecular Formula | C6H13NO6S |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | hydrogen sulfate;2-(2-methylprop-2-enoyloxy)ethylazanium |
| SMILES | C=C(C)C(=O)OCC[NH3+].O=S(=O)([O-])O |
| InChI | InChI=1S/C6H11NO2.H2O4S/c1-5(2)6(8)9-4-3-7;1-5(2,3)4/h1,3-4,7H2,2H3;(H2,1,2,3,4) |
| InChIKey | LRBSRRALUJHYDS-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 131.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|