C12H17NO5S — CID 88734016
benzenesulfonate;2-(2-methylprop-2-enoyloxy)ethylazanium (PubChem CID 88734016) has the molecular formula C12H17NO5S and a molecular weight of 287.34 g/mol. Its IUPAC name is benzenesulfonate;2-(2-methylprop-2-enoyloxy)ethylazanium.
| Compound Name | benzenesulfonate;2-(2-methylprop-2-enoyloxy)ethylazanium |
|---|---|
| PubChem CID | 88734016 |
| Molecular Formula | C12H17NO5S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | benzenesulfonate;2-(2-methylprop-2-enoyloxy)ethylazanium |
| SMILES | C=C(C)C(=O)OCC[NH3+].O=S(=O)([O-])c1ccccc1 |
| InChI | InChI=1S/C6H11NO2.C6H6O3S/c1-5(2)6(8)9-4-3-7;7-10(8,9)6-4-2-1-3-5-6/h1,3-4,7H2,2H3;1-5H,(H,7,8,9) |
| InChIKey | TUZXMBHYRBZGRN-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|