C6H20Cl3N3O2 — CID 143861724
diazanium;2-(2-methylprop-2-enoyloxy)ethylazanium;trichloride (PubChem CID 143861724) has the molecular formula C6H20Cl3N3O2 and a molecular weight of 272.60 g/mol. Its IUPAC name is diazanium;2-(2-methylprop-2-enoyloxy)ethylazanium;trichloride.
| Compound Name | diazanium;2-(2-methylprop-2-enoyloxy)ethylazanium;trichloride |
|---|---|
| PubChem CID | 143861724 |
| Molecular Formula | C6H20Cl3N3O2 |
| Molecular Weight | 272.60 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | diazanium;2-(2-methylprop-2-enoyloxy)ethylazanium;trichloride |
| SMILES | C=C(C)C(=O)OCC[NH3+].[Cl-].[Cl-].[Cl-].[NH4+].[NH4+] |
| InChI | InChI=1S/C6H11NO2.3ClH.2H3N/c1-5(2)6(8)9-4-3-7;;;;;/h1,3-4,7H2,2H3;3*1H;2*1H3 |
| InChIKey | OBOMGSZOOFGARQ-UHFFFAOYSA-N |
| XLogP | -8.89 |
| TPSA | 126.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.60 |
| LogP ≤ 5 | -8.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|