C8H15AsO2 — CID 87191612
2-dimethylarsanylethyl 2-methylprop-2-enoate (PubChem CID 87191612) has the molecular formula C8H15AsO2 and a molecular weight of 218.13 g/mol. Its IUPAC name is 2-dimethylarsanylethyl 2-methylprop-2-enoate.
| Compound Name | 2-dimethylarsanylethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87191612 |
| Molecular Formula | C8H15AsO2 |
| Molecular Weight | 218.13 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 2-dimethylarsanylethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC[As](C)C |
| InChI | InChI=1S/C8H15AsO2/c1-7(2)8(10)11-6-5-9(3)4/h1,5-6H2,2-4H3 |
| InChIKey | IXGCAIZOPORNJC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.13 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|