C19H28N2O2+2 — CID 23405242
2-(4-benzyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)ethyl 2-methylprop-2-enoate (PubChem CID 23405242) has the molecular formula C19H28N2O2+2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 2-(4-benzyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(4-benzyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 23405242 |
| Molecular Formula | C19H28N2O2+2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | 2-(4-benzyl-1,4-diazoniabicyclo[2.2.2]octan-1-yl)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC[N+]12CC[N+](Cc3ccccc3)(CC1)CC2 |
| InChI | InChI=1S/C19H28N2O2/c1-17(2)19(22)23-15-14-20-8-11-21(12-9-20,13-10-20)16-18-6-4-3-5-7-18/h3-7H,1,8-16H2,2H3/q+2 |
| InChIKey | XJCBIYDSFPZODJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|