C26H24O5S — CID 19020041
2-[4-[(E)-2-[4-(benzenesulfonyl)phenyl]ethenyl]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 19020041) has the molecular formula C26H24O5S and a molecular weight of 448.54 g/mol. Its IUPAC name is 2-[4-[(E)-2-[4-(benzenesulfonyl)phenyl]ethenyl]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[(E)-2-[4-(benzenesulfonyl)phenyl]ethenyl]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 19020041 |
| Molecular Formula | C26H24O5S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 2-[4-[(E)-2-[4-(benzenesulfonyl)phenyl]ethenyl]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(/C=C/c2ccc(S(=O)(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H24O5S/c1-20(2)26(27)31-19-18-30-23-14-10-21(11-15-23)8-9-22-12-16-25(17-13-22)32(28,29)24-6-4-3-5-7-24/h3-17H,1,18-19H2,2H3/b9-8+ |
| InChIKey | HHNVDIRZUCBVMC-CMDGGOBGSA-N |
| XLogP | 5.19 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|