C30H30O7S2 — CID 66808695
2-[4-[4-[4-[2-(2-methylprop-2-enoyloxy)ethylsulfanyl]phenyl]phenyl]sulfonylphenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 66808695) has the molecular formula C30H30O7S2 and a molecular weight of 566.70 g/mol. Its IUPAC name is 2-[4-[4-[4-[2-(2-methylprop-2-enoyloxy)ethylsulfanyl]phenyl]phenyl]sulfonylphenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[4-[4-[2-(2-methylprop-2-enoyloxy)ethylsulfanyl]phenyl]phenyl]sulfonylphenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 66808695 |
| Molecular Formula | C30H30O7S2 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.14 |
| IUPAC Name | 2-[4-[4-[4-[2-(2-methylprop-2-enoyloxy)ethylsulfanyl]phenyl]phenyl]sulfonylphenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(S(=O)(=O)c2ccc(-c3ccc(SCCOC(=O)C(=C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H30O7S2/c1-21(2)29(31)36-18-17-35-25-9-15-28(16-10-25)39(33,34)27-13-7-24(8-14-27)23-5-11-26(12-6-23)38-20-19-37-30(32)22(3)4/h5-16H,1,3,17-20H2,2,4H3 |
| InChIKey | OOANLQZMBVHILS-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|