C37H34O6S — CID 146512335
2-[4-[4-[4-[4-[2-(2-methylprop-2-enoyloxy)ethylsulfanyl]phenyl]benzoyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 146512335) has the molecular formula C37H34O6S and a molecular weight of 606.74 g/mol. Its IUPAC name is 2-[4-[4-[4-[4-[2-(2-methylprop-2-enoyloxy)ethylsulfanyl]phenyl]benzoyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[4-[4-[4-[2-(2-methylprop-2-enoyloxy)ethylsulfanyl]phenyl]benzoyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146512335 |
| Molecular Formula | C37H34O6S |
| Molecular Weight | 606.74 g/mol |
| Exact Mass | 606.21 |
| IUPAC Name | 2-[4-[4-[4-[4-[2-(2-methylprop-2-enoyloxy)ethylsulfanyl]phenyl]benzoyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1ccc(-c2ccc(C(=O)c3ccc(-c4ccc(SCCOC(=O)C(=C)C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H34O6S/c1-25(2)36(39)42-22-21-41-33-17-13-29(14-18-33)27-5-9-31(10-6-27)35(38)32-11-7-28(8-12-32)30-15-19-34(20-16-30)44-24-23-43-37(40)26(3)4/h5-20H,1,3,21-24H2,2,4H3 |
| InChIKey | JDRXALWUPNZZOO-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.74 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|