C27H30O5 — CID 121309000
bis[4-[2-(3-methylbuta-1,3-dien-2-yloxy)ethoxy]phenyl]methanone (PubChem CID 121309000) has the molecular formula C27H30O5 and a molecular weight of 434.53 g/mol. Its IUPAC name is bis[4-[2-(3-methylbuta-1,3-dien-2-yloxy)ethoxy]phenyl]methanone.
| Compound Name | bis[4-[2-(3-methylbuta-1,3-dien-2-yloxy)ethoxy]phenyl]methanone |
|---|---|
| PubChem CID | 121309000 |
| Molecular Formula | C27H30O5 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | bis[4-[2-(3-methylbuta-1,3-dien-2-yloxy)ethoxy]phenyl]methanone |
| SMILES | C=C(C)C(=C)OCCOc1ccc(C(=O)c2ccc(OCCOC(=C)C(=C)C)cc2)cc1 |
| InChI | InChI=1S/C27H30O5/c1-19(2)21(5)29-15-17-31-25-11-7-23(8-12-25)27(28)24-9-13-26(14-10-24)32-18-16-30-22(6)20(3)4/h7-14H,1,3,5-6,15-18H2,2,4H3 |
| InChIKey | ZGLNEYDPQUNHPX-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|