C12H14O3S — CID 57001290
2-(4-hydroxyphenyl)sulfanylethyl 2-methylprop-2-enoate (PubChem CID 57001290) has the molecular formula C12H14O3S and a molecular weight of 238.31 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)sulfanylethyl 2-methylprop-2-enoate.
| Compound Name | 2-(4-hydroxyphenyl)sulfanylethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 57001290 |
| Molecular Formula | C12H14O3S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 2-(4-hydroxyphenyl)sulfanylethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCSc1ccc(O)cc1 |
| InChI | InChI=1S/C12H14O3S/c1-9(2)12(14)15-7-8-16-11-5-3-10(13)4-6-11/h3-6,13H,1,7-8H2,2H3 |
| InChIKey | NTRIBHXBZXAONA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|