C20H27NO4S — CID 23325645
2-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylethyl 2-methylprop-2-enoate (PubChem CID 23325645) has the molecular formula C20H27NO4S and a molecular weight of 377.51 g/mol. Its IUPAC name is 2-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 23325645 |
| Molecular Formula | C20H27NO4S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 2-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCSc1ccc(C(=O)C(C)(C)N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H27NO4S/c1-15(2)19(23)25-13-14-26-17-7-5-16(6-8-17)18(22)20(3,4)21-9-11-24-12-10-21/h5-8H,1,9-14H2,2-4H3 |
| InChIKey | PNFYUBANGAKTBF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|