C22H25NO2S — CID 18755073
2-methyl-2-morpholin-4-yl-1-[4-(1-phenylethenylsulfanyl)phenyl]propan-1-one (PubChem CID 18755073) has the molecular formula C22H25NO2S and a molecular weight of 367.51 g/mol. Its IUPAC name is 2-methyl-2-morpholin-4-yl-1-[4-(1-phenylethenylsulfanyl)phenyl]propan-1-one.
| Compound Name | 2-methyl-2-morpholin-4-yl-1-[4-(1-phenylethenylsulfanyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 18755073 |
| Molecular Formula | C22H25NO2S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 2-methyl-2-morpholin-4-yl-1-[4-(1-phenylethenylsulfanyl)phenyl]propan-1-one |
| SMILES | C=C(Sc1ccc(C(=O)C(C)(C)N2CCOCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H25NO2S/c1-17(18-7-5-4-6-8-18)26-20-11-9-19(10-12-20)21(24)22(2,3)23-13-15-25-16-14-23/h4-12H,1,13-16H2,2-3H3 |
| InChIKey | FXSIHBCFJZHFKM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |