C15H19NO3S — CID 87506630
S-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl] methanethioate (PubChem CID 87506630) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is S-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl] methanethioate.
| Compound Name | S-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl] methanethioate |
|---|---|
| PubChem CID | 87506630 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | S-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl] methanethioate |
| SMILES | CC(C)(C(=O)c1ccc(SC=O)cc1)N1CCOCC1 |
| InChI | InChI=1S/C15H19NO3S/c1-15(2,16-7-9-19-10-8-16)14(18)12-3-5-13(6-4-12)20-11-17/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | OUPVJJBKGOQIHT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|