C18H23NO6S — CID 144999377
2-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylbutanedioic acid (PubChem CID 144999377) has the molecular formula C18H23NO6S and a molecular weight of 381.45 g/mol. Its IUPAC name is 2-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylbutanedioic acid.
| Compound Name | 2-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylbutanedioic acid |
|---|---|
| PubChem CID | 144999377 |
| Molecular Formula | C18H23NO6S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 2-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylbutanedioic acid |
| SMILES | CC(C)(C(=O)c1ccc(SC(CC(=O)O)C(=O)O)cc1)N1CCOCC1 |
| InChI | InChI=1S/C18H23NO6S/c1-18(2,19-7-9-25-10-8-19)16(22)12-3-5-13(6-4-12)26-14(17(23)24)11-15(20)21/h3-6,14H,7-11H2,1-2H3,(H,20,21)(H,23,24) |
| InChIKey | AMRVOBURKRDNNM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |