C16H23LiNO3S- — CID 165164955
lithium;1-(4-ethylsulfanylphenyl)-2-methyl-2-morpholin-4-ylpropan-1-one;hydroxide (PubChem CID 165164955) has the molecular formula C16H23LiNO3S- and a molecular weight of 316.37 g/mol. Its IUPAC name is lithium;1-(4-ethylsulfanylphenyl)-2-methyl-2-morpholin-4-ylpropan-1-one;hydroxide.
| Compound Name | lithium;1-(4-ethylsulfanylphenyl)-2-methyl-2-morpholin-4-ylpropan-1-one;hydroxide |
|---|---|
| PubChem CID | 165164955 |
| Molecular Formula | C16H23LiNO3S- |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | lithium;1-(4-ethylsulfanylphenyl)-2-methyl-2-morpholin-4-ylpropan-1-one;hydroxide |
| SMILES | [CH2-]CSc1ccc(C(=O)C(C)(C)N2CCOCC2)cc1.[Li+].[OH-] |
| InChI | InChI=1S/C16H22NO2S.Li.H2O/c1-4-20-14-7-5-13(6-8-14)15(18)16(2,3)17-9-11-19-12-10-17;;/h5-8H,1,4,9-12H2,2-3H3;;1H2/q-1;+1;/p-1 |
| InChIKey | GYKDVOCRXOLFBA-UHFFFAOYSA-M |
| XLogP | -0.27 |
| TPSA | 59.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|