C20H32N2O5S2 — CID 118136936
3-[methyl-[2-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylethyl]amino]propane-1-sulfonic acid (PubChem CID 118136936) has the molecular formula C20H32N2O5S2 and a molecular weight of 444.62 g/mol. Its IUPAC name is 3-[methyl-[2-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylethyl]amino]propane-1-sulfonic acid.
| Compound Name | 3-[methyl-[2-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylethyl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 118136936 |
| Molecular Formula | C20H32N2O5S2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 3-[methyl-[2-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylethyl]amino]propane-1-sulfonic acid |
| SMILES | CN(CCCS(=O)(=O)O)CCSc1ccc(C(=O)C(C)(C)N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H32N2O5S2/c1-20(2,22-10-13-27-14-11-22)19(23)17-5-7-18(8-6-17)28-15-12-21(3)9-4-16-29(24,25)26/h5-8H,4,9-16H2,1-3H3,(H,24,25,26) |
| InChIKey | NKKOTKOIUGOHBN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|