C21H29NO4S2 — CID 18755071
2-[3-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylpropylsulfanylmethyl]prop-2-enoic acid (PubChem CID 18755071) has the molecular formula C21H29NO4S2 and a molecular weight of 423.60 g/mol. Its IUPAC name is 2-[3-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylpropylsulfanylmethyl]prop-2-enoic acid.
| Compound Name | 2-[3-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylpropylsulfanylmethyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 18755071 |
| Molecular Formula | C21H29NO4S2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 2-[3-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylpropylsulfanylmethyl]prop-2-enoic acid |
| SMILES | C=C(CSCCCSc1ccc(C(=O)C(C)(C)N2CCOCC2)cc1)C(=O)O |
| InChI | InChI=1S/C21H29NO4S2/c1-16(20(24)25)15-27-13-4-14-28-18-7-5-17(6-8-18)19(23)21(2,3)22-9-11-26-12-10-22/h5-8H,1,4,9-15H2,2-3H3,(H,24,25) |
| InChIKey | GHPGAKZTSLCYGA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|