C26H33NO3S2 — CID 18755063
2-[3-[4-[2-benzyl-2-(dimethylamino)butanoyl]phenyl]sulfanylpropylsulfanylmethyl]prop-2-enoic acid (PubChem CID 18755063) has the molecular formula C26H33NO3S2 and a molecular weight of 471.69 g/mol. Its IUPAC name is 2-[3-[4-[2-benzyl-2-(dimethylamino)butanoyl]phenyl]sulfanylpropylsulfanylmethyl]prop-2-enoic acid.
| Compound Name | 2-[3-[4-[2-benzyl-2-(dimethylamino)butanoyl]phenyl]sulfanylpropylsulfanylmethyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 18755063 |
| Molecular Formula | C26H33NO3S2 |
| Molecular Weight | 471.69 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 2-[3-[4-[2-benzyl-2-(dimethylamino)butanoyl]phenyl]sulfanylpropylsulfanylmethyl]prop-2-enoic acid |
| SMILES | C=C(CSCCCSc1ccc(C(=O)C(CC)(Cc2ccccc2)N(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C26H33NO3S2/c1-5-26(27(3)4,18-21-10-7-6-8-11-21)24(28)22-12-14-23(15-13-22)32-17-9-16-31-19-20(2)25(29)30/h6-8,10-15H,2,5,9,16-19H2,1,3-4H3,(H,29,30) |
| InChIKey | QNXUBGOXYYXHOL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.69 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|