C21H26Cl2FNO — CID 158663548
2-benzyl-2-(dimethylamino)-1-(4-fluorophenyl)butan-1-one;1,1-dichloroethane (PubChem CID 158663548) has the molecular formula C21H26Cl2FNO and a molecular weight of 398.35 g/mol. Its IUPAC name is 2-benzyl-2-(dimethylamino)-1-(4-fluorophenyl)butan-1-one;1,1-dichloroethane.
| Compound Name | 2-benzyl-2-(dimethylamino)-1-(4-fluorophenyl)butan-1-one;1,1-dichloroethane |
|---|---|
| PubChem CID | 158663548 |
| Molecular Formula | C21H26Cl2FNO |
| Molecular Weight | 398.35 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 2-benzyl-2-(dimethylamino)-1-(4-fluorophenyl)butan-1-one;1,1-dichloroethane |
| SMILES | CC(Cl)Cl.CCC(Cc1ccccc1)(C(=O)c1ccc(F)cc1)N(C)C |
| InChI | InChI=1S/C19H22FNO.C2H4Cl2/c1-4-19(21(2)3,14-15-8-6-5-7-9-15)18(22)16-10-12-17(20)13-11-16;1-2(3)4/h5-13H,4,14H2,1-3H3;2H,1H3 |
| InChIKey | IDBFNCILGNTMGX-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.35 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|