C22H31NO3 — CID 158870745
2-benzyl-2-(dimethylamino)-1-[4-(2-hydroxyethoxy)phenyl]butan-1-one;methane (PubChem CID 158870745) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is 2-benzyl-2-(dimethylamino)-1-[4-(2-hydroxyethoxy)phenyl]butan-1-one;methane.
| Compound Name | 2-benzyl-2-(dimethylamino)-1-[4-(2-hydroxyethoxy)phenyl]butan-1-one;methane |
|---|---|
| PubChem CID | 158870745 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 2-benzyl-2-(dimethylamino)-1-[4-(2-hydroxyethoxy)phenyl]butan-1-one;methane |
| SMILES | C.CCC(Cc1ccccc1)(C(=O)c1ccc(OCCO)cc1)N(C)C |
| InChI | InChI=1S/C21H27NO3.CH4/c1-4-21(22(2)3,16-17-8-6-5-7-9-17)20(24)18-10-12-19(13-11-18)25-15-14-23;/h5-13,23H,4,14-16H2,1-3H3;1H4 |
| InChIKey | JBUSSOONZAMZGO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |