C24H25NO — CID 19049414
2-benzyl-2-(dimethylamino)-1,3-diphenylpropan-1-one (PubChem CID 19049414) has the molecular formula C24H25NO and a molecular weight of 343.47 g/mol. Its IUPAC name is 2-benzyl-2-(dimethylamino)-1,3-diphenylpropan-1-one.
| Compound Name | 2-benzyl-2-(dimethylamino)-1,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 19049414 |
| Molecular Formula | C24H25NO |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 2-benzyl-2-(dimethylamino)-1,3-diphenylpropan-1-one |
| SMILES | CN(C)C(Cc1ccccc1)(Cc1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H25NO/c1-25(2)24(18-20-12-6-3-7-13-20,19-21-14-8-4-9-15-21)23(26)22-16-10-5-11-17-22/h3-17H,18-19H2,1-2H3 |
| InChIKey | GRUYMSAOHDNREH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |