C26H35N3O2 — CID 138623146
3-[4-[4-[2-benzyl-2-(dimethylamino)butanoyl]phenyl]piperazin-1-yl]propanal (PubChem CID 138623146) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 3-[4-[4-[2-benzyl-2-(dimethylamino)butanoyl]phenyl]piperazin-1-yl]propanal.
| Compound Name | 3-[4-[4-[2-benzyl-2-(dimethylamino)butanoyl]phenyl]piperazin-1-yl]propanal |
|---|---|
| PubChem CID | 138623146 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | 3-[4-[4-[2-benzyl-2-(dimethylamino)butanoyl]phenyl]piperazin-1-yl]propanal |
| SMILES | CCC(Cc1ccccc1)(C(=O)c1ccc(N2CCN(CCC=O)CC2)cc1)N(C)C |
| InChI | InChI=1S/C26H35N3O2/c1-4-26(27(2)3,21-22-9-6-5-7-10-22)25(31)23-11-13-24(14-12-23)29-18-16-28(17-19-29)15-8-20-30/h5-7,9-14,20H,4,8,15-19,21H2,1-3H3 |
| InChIKey | DXVBDPMFQJQILM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|