C25H36N4O2 — CID 145400664
4-[2-(dimethylamino)-2-(4-piperazin-1-ylbenzoyl)butyl]benzaldehyde;methanamine (PubChem CID 145400664) has the molecular formula C25H36N4O2 and a molecular weight of 424.59 g/mol. Its IUPAC name is 4-[2-(dimethylamino)-2-(4-piperazin-1-ylbenzoyl)butyl]benzaldehyde;methanamine.
| Compound Name | 4-[2-(dimethylamino)-2-(4-piperazin-1-ylbenzoyl)butyl]benzaldehyde;methanamine |
|---|---|
| PubChem CID | 145400664 |
| Molecular Formula | C25H36N4O2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | 4-[2-(dimethylamino)-2-(4-piperazin-1-ylbenzoyl)butyl]benzaldehyde;methanamine |
| SMILES | CCC(Cc1ccc(C=O)cc1)(C(=O)c1ccc(N2CCNCC2)cc1)N(C)C.CN |
| InChI | InChI=1S/C24H31N3O2.CH5N/c1-4-24(26(2)3,17-19-5-7-20(18-28)8-6-19)23(29)21-9-11-22(12-10-21)27-15-13-25-14-16-27;1-2/h5-12,18,25H,4,13-17H2,1-3H3;2H2,1H3 |
| InChIKey | LTRJEUUDLANWSS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|