C24H33N3O4S — CID 153307368
methyl 4-[2-(dimethylamino)-2-(4-piperazin-1-ylbenzoyl)butyl]benzenesulfonate (PubChem CID 153307368) has the molecular formula C24H33N3O4S and a molecular weight of 459.61 g/mol. Its IUPAC name is methyl 4-[2-(dimethylamino)-2-(4-piperazin-1-ylbenzoyl)butyl]benzenesulfonate.
| Compound Name | methyl 4-[2-(dimethylamino)-2-(4-piperazin-1-ylbenzoyl)butyl]benzenesulfonate |
|---|---|
| PubChem CID | 153307368 |
| Molecular Formula | C24H33N3O4S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | methyl 4-[2-(dimethylamino)-2-(4-piperazin-1-ylbenzoyl)butyl]benzenesulfonate |
| SMILES | CCC(Cc1ccc(S(=O)(=O)OC)cc1)(C(=O)c1ccc(N2CCNCC2)cc1)N(C)C |
| InChI | InChI=1S/C24H33N3O4S/c1-5-24(26(2)3,18-19-6-12-22(13-7-19)32(29,30)31-4)23(28)20-8-10-21(11-9-20)27-16-14-25-15-17-27/h6-13,25H,5,14-18H2,1-4H3 |
| InChIKey | HRNLCIUIAYGOOU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|