C24H34N2O2 — CID 139417323
2-benzyl-2-(dimethylamino)-1-[4-[2-ethoxyethyl(methyl)amino]phenyl]butan-1-one (PubChem CID 139417323) has the molecular formula C24H34N2O2 and a molecular weight of 382.55 g/mol. Its IUPAC name is 2-benzyl-2-(dimethylamino)-1-[4-[2-ethoxyethyl(methyl)amino]phenyl]butan-1-one.
| Compound Name | 2-benzyl-2-(dimethylamino)-1-[4-[2-ethoxyethyl(methyl)amino]phenyl]butan-1-one |
|---|---|
| PubChem CID | 139417323 |
| Molecular Formula | C24H34N2O2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | 2-benzyl-2-(dimethylamino)-1-[4-[2-ethoxyethyl(methyl)amino]phenyl]butan-1-one |
| SMILES | CCOCCN(C)c1ccc(C(=O)C(CC)(Cc2ccccc2)N(C)C)cc1 |
| InChI | InChI=1S/C24H34N2O2/c1-6-24(25(3)4,19-20-11-9-8-10-12-20)23(27)21-13-15-22(16-14-21)26(5)17-18-28-7-2/h8-16H,6-7,17-19H2,1-5H3 |
| InChIKey | WRHUOWQSIDMYCG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|