C14H20Cl2FNO — CID 174893820
1,1-dichloroethane;2-(dimethylamino)-1-(4-fluorophenyl)butan-1-one (PubChem CID 174893820) has the molecular formula C14H20Cl2FNO and a molecular weight of 308.22 g/mol. Its IUPAC name is 1,1-dichloroethane;2-(dimethylamino)-1-(4-fluorophenyl)butan-1-one.
| Compound Name | 1,1-dichloroethane;2-(dimethylamino)-1-(4-fluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 174893820 |
| Molecular Formula | C14H20Cl2FNO |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 1,1-dichloroethane;2-(dimethylamino)-1-(4-fluorophenyl)butan-1-one |
| SMILES | CC(Cl)Cl.CCC(C(=O)c1ccc(F)cc1)N(C)C |
| InChI | InChI=1S/C12H16FNO.C2H4Cl2/c1-4-11(14(2)3)12(15)9-5-7-10(13)8-6-9;1-2(3)4/h5-8,11H,4H2,1-3H3;2H,1H3 |
| InChIKey | VGTYFRLJONIHFF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|