C12H15FO — CID 143361678
(2S)-1-(4-fluorophenyl)-2,3-dimethylbutan-1-one (PubChem CID 143361678) has the molecular formula C12H15FO and a molecular weight of 194.25 g/mol. Its IUPAC name is (2S)-1-(4-fluorophenyl)-2,3-dimethylbutan-1-one.
| Compound Name | (2S)-1-(4-fluorophenyl)-2,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 143361678 |
| Molecular Formula | C12H15FO |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (2S)-1-(4-fluorophenyl)-2,3-dimethylbutan-1-one |
| SMILES | CC(C)[C@H](C)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H15FO/c1-8(2)9(3)12(14)10-4-6-11(13)7-5-10/h4-9H,1-3H3/t9-/m0/s1 |
| InChIKey | WRRXHCWJIAHKCE-VIFPVBQESA-N |
| XLogP | 3.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |