C29H36N2O3 — CID 57323188
1-[4-[4-acetyl-2-(3-methoxypropyl)pyrrol-2-yl]phenyl]-2-benzyl-2-(dimethylamino)butan-1-one (PubChem CID 57323188) has the molecular formula C29H36N2O3 and a molecular weight of 460.62 g/mol. Its IUPAC name is 1-[4-[4-acetyl-2-(3-methoxypropyl)pyrrol-2-yl]phenyl]-2-benzyl-2-(dimethylamino)butan-1-one.
| Compound Name | 1-[4-[4-acetyl-2-(3-methoxypropyl)pyrrol-2-yl]phenyl]-2-benzyl-2-(dimethylamino)butan-1-one |
|---|---|
| PubChem CID | 57323188 |
| Molecular Formula | C29H36N2O3 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | 1-[4-[4-acetyl-2-(3-methoxypropyl)pyrrol-2-yl]phenyl]-2-benzyl-2-(dimethylamino)butan-1-one |
| SMILES | CCC(Cc1ccccc1)(C(=O)c1ccc(C2(CCCOC)C=C(C(C)=O)C=N2)cc1)N(C)C |
| InChI | InChI=1S/C29H36N2O3/c1-6-29(31(3)4,19-23-11-8-7-9-12-23)27(33)24-13-15-26(16-14-24)28(17-10-18-34-5)20-25(21-30-28)22(2)32/h7-9,11-16,20-21H,6,10,17-19H2,1-5H3 |
| InChIKey | WPHYFJOKRXEWQW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|