C22H27NO4S — CID 129155311
1-[4-[4-(2-hydroxyethoxy)phenyl]sulfanylphenyl]-2-methyl-2-morpholin-4-ylpropan-1-one (PubChem CID 129155311) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is 1-[4-[4-(2-hydroxyethoxy)phenyl]sulfanylphenyl]-2-methyl-2-morpholin-4-ylpropan-1-one.
| Compound Name | 1-[4-[4-(2-hydroxyethoxy)phenyl]sulfanylphenyl]-2-methyl-2-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 129155311 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 1-[4-[4-(2-hydroxyethoxy)phenyl]sulfanylphenyl]-2-methyl-2-morpholin-4-ylpropan-1-one |
| SMILES | CC(C)(C(=O)c1ccc(Sc2ccc(OCCO)cc2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C22H27NO4S/c1-22(2,23-11-14-26-15-12-23)21(25)17-3-7-19(8-4-17)28-20-9-5-18(6-10-20)27-16-13-24/h3-10,24H,11-16H2,1-2H3 |
| InChIKey | FBXDOARJEITXFL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |