C23H43NO4Si2 — CID 157392457
1-[4-[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]phenyl]-2-methyl-2-morpholin-4-ylpropan-1-one;methane (PubChem CID 157392457) has the molecular formula C23H43NO4Si2 and a molecular weight of 453.77 g/mol. Its IUPAC name is 1-[4-[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]phenyl]-2-methyl-2-morpholin-4-ylpropan-1-one;methane.
| Compound Name | 1-[4-[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]phenyl]-2-methyl-2-morpholin-4-ylpropan-1-one;methane |
|---|---|
| PubChem CID | 157392457 |
| Molecular Formula | C23H43NO4Si2 |
| Molecular Weight | 453.77 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | 1-[4-[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]phenyl]-2-methyl-2-morpholin-4-ylpropan-1-one;methane |
| SMILES | C.CC(C)(C(=O)c1ccc(OCCC[Si](C)(C)O[Si](C)(C)C)cc1)N1CCOCC1 |
| InChI | InChI=1S/C22H39NO4Si2.CH4/c1-22(2,23-13-16-25-17-14-23)21(24)19-9-11-20(12-10-19)26-15-8-18-29(6,7)27-28(3,4)5;/h9-12H,8,13-18H2,1-7H3;1H4 |
| InChIKey | BMDXXMFANFAITK-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.77 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|