C18H27NO5 — CID 19867019
1-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-2-methyl-2-morpholin-4-ylpropan-1-one (PubChem CID 19867019) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-2-methyl-2-morpholin-4-ylpropan-1-one.
| Compound Name | 1-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-2-methyl-2-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 19867019 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 1-[4-[2-(2-hydroxyethoxy)ethoxy]phenyl]-2-methyl-2-morpholin-4-ylpropan-1-one |
| SMILES | CC(C)(C(=O)c1ccc(OCCOCCO)cc1)N1CCOCC1 |
| InChI | InChI=1S/C18H27NO5/c1-18(2,19-7-10-22-11-8-19)17(21)15-3-5-16(6-4-15)24-14-13-23-12-9-20/h3-6,20H,7-14H2,1-2H3 |
| InChIKey | VSXPAYZFJRKFNF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|