C21H39NO5Si3 — CID 18728755
2-methyl-1-[4-[methyl-bis(trimethylsilyloxy)silyl]oxyphenyl]-2-morpholin-4-ylpropan-1-one (PubChem CID 18728755) has the molecular formula C21H39NO5Si3 and a molecular weight of 469.80 g/mol. Its IUPAC name is 2-methyl-1-[4-[methyl-bis(trimethylsilyloxy)silyl]oxyphenyl]-2-morpholin-4-ylpropan-1-one.
| Compound Name | 2-methyl-1-[4-[methyl-bis(trimethylsilyloxy)silyl]oxyphenyl]-2-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 18728755 |
| Molecular Formula | C21H39NO5Si3 |
| Molecular Weight | 469.80 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 2-methyl-1-[4-[methyl-bis(trimethylsilyloxy)silyl]oxyphenyl]-2-morpholin-4-ylpropan-1-one |
| SMILES | CC(C)(C(=O)c1ccc(O[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)cc1)N1CCOCC1 |
| InChI | InChI=1S/C21H39NO5Si3/c1-21(2,22-14-16-24-17-15-22)20(23)18-10-12-19(13-11-18)25-30(9,26-28(3,4)5)27-29(6,7)8/h10-13H,14-17H2,1-9H3 |
| InChIKey | QIDWUXVKMUJRGX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.80 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|