C24H45NO5Si3 — CID 18728748
2-methyl-1-[4-[2-[methyl-bis(trimethylsilyloxy)silyl]propoxy]phenyl]-2-morpholin-4-ylpropan-1-one (PubChem CID 18728748) has the molecular formula C24H45NO5Si3 and a molecular weight of 511.88 g/mol. Its IUPAC name is 2-methyl-1-[4-[2-[methyl-bis(trimethylsilyloxy)silyl]propoxy]phenyl]-2-morpholin-4-ylpropan-1-one.
| Compound Name | 2-methyl-1-[4-[2-[methyl-bis(trimethylsilyloxy)silyl]propoxy]phenyl]-2-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 18728748 |
| Molecular Formula | C24H45NO5Si3 |
| Molecular Weight | 511.88 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | 2-methyl-1-[4-[2-[methyl-bis(trimethylsilyloxy)silyl]propoxy]phenyl]-2-morpholin-4-ylpropan-1-one |
| SMILES | CC(COc1ccc(C(=O)C(C)(C)N2CCOCC2)cc1)[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C24H45NO5Si3/c1-20(33(10,29-31(4,5)6)30-32(7,8)9)19-28-22-13-11-21(12-14-22)23(26)24(2,3)25-15-17-27-18-16-25/h11-14,20H,15-19H2,1-10H3 |
| InChIKey | DLZXGYBSUIYTDP-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.88 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|