C20H23NO2S — CID 19879538
2-methyl-2-morpholin-4-yl-1-(4-phenylsulfanylphenyl)propan-1-one (PubChem CID 19879538) has the molecular formula C20H23NO2S and a molecular weight of 341.48 g/mol. Its IUPAC name is 2-methyl-2-morpholin-4-yl-1-(4-phenylsulfanylphenyl)propan-1-one.
| Compound Name | 2-methyl-2-morpholin-4-yl-1-(4-phenylsulfanylphenyl)propan-1-one |
|---|---|
| PubChem CID | 19879538 |
| Molecular Formula | C20H23NO2S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-methyl-2-morpholin-4-yl-1-(4-phenylsulfanylphenyl)propan-1-one |
| SMILES | CC(C)(C(=O)c1ccc(Sc2ccccc2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C20H23NO2S/c1-20(2,21-12-14-23-15-13-21)19(22)16-8-10-18(11-9-16)24-17-6-4-3-5-7-17/h3-11H,12-15H2,1-2H3 |
| InChIKey | XLJRUFAMEBYVJS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |