C28H28N2O5S2 — CID 162463792
[(Z)-[2-[4-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylphenyl]-2-oxo-1-thiophen-2-ylethylidene]amino] acetate (PubChem CID 162463792) has the molecular formula C28H28N2O5S2 and a molecular weight of 536.68 g/mol. Its IUPAC name is [(Z)-[2-[4-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylphenyl]-2-oxo-1-thiophen-2-ylethylidene]amino] acetate.
| Compound Name | [(Z)-[2-[4-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylphenyl]-2-oxo-1-thiophen-2-ylethylidene]amino] acetate |
|---|---|
| PubChem CID | 162463792 |
| Molecular Formula | C28H28N2O5S2 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | [(Z)-[2-[4-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylphenyl]-2-oxo-1-thiophen-2-ylethylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(/C(=O)c1ccc(Sc2ccc(C(=O)C(C)(C)N3CCOCC3)cc2)cc1)c1cccs1 |
| InChI | InChI=1S/C28H28N2O5S2/c1-19(31)35-29-25(24-5-4-18-36-24)26(32)20-6-10-22(11-7-20)37-23-12-8-21(9-13-23)27(33)28(2,3)30-14-16-34-17-15-30/h4-13,18H,14-17H2,1-3H3/b29-25+ |
| InChIKey | DGOFUMGHSIOTHP-XLVZBRSZSA-N |
| XLogP | 5.34 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|