C30H35ClN2O6S — CID 162463708
[(E)-[3-(2-hydroxycyclohexyl)-1-[4-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylphenyl]-1-oxopropan-2-ylidene]amino] carbonochloridate (PubChem CID 162463708) has the molecular formula C30H35ClN2O6S and a molecular weight of 587.14 g/mol. Its IUPAC name is [(E)-[3-(2-hydroxycyclohexyl)-1-[4-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylphenyl]-1-oxopropan-2-ylidene]amino] carbonochloridate.
| Compound Name | [(E)-[3-(2-hydroxycyclohexyl)-1-[4-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylphenyl]-1-oxopropan-2-ylidene]amino] carbonochloridate |
|---|---|
| PubChem CID | 162463708 |
| Molecular Formula | C30H35ClN2O6S |
| Molecular Weight | 587.14 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | [(E)-[3-(2-hydroxycyclohexyl)-1-[4-[4-(2-methyl-2-morpholin-4-ylpropanoyl)phenyl]sulfanylphenyl]-1-oxopropan-2-ylidene]amino] carbonochloridate |
| SMILES | CC(C)(C(=O)c1ccc(Sc2ccc(C(=O)/C(CC3CCCCC3O)=N/OC(=O)Cl)cc2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C30H35ClN2O6S/c1-30(2,33-15-17-38-18-16-33)28(36)21-9-13-24(14-10-21)40-23-11-7-20(8-12-23)27(35)25(32-39-29(31)37)19-22-5-3-4-6-26(22)34/h7-14,22,26,34H,3-6,15-19H2,1-2H3/b32-25+ |
| InChIKey | FCYVLNRNYBQHOJ-WGPBWIAQSA-N |
| XLogP | 5.99 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.14 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|