C26H28ClN3O5 — CID 162463656
[(Z)-[1-chloro-2-[9-ethyl-6-(2-methyl-2-morpholin-4-ylpropanoyl)carbazol-3-yl]-2-oxoethylidene]amino] acetate (PubChem CID 162463656) has the molecular formula C26H28ClN3O5 and a molecular weight of 497.98 g/mol. Its IUPAC name is [(Z)-[1-chloro-2-[9-ethyl-6-(2-methyl-2-morpholin-4-ylpropanoyl)carbazol-3-yl]-2-oxoethylidene]amino] acetate.
| Compound Name | [(Z)-[1-chloro-2-[9-ethyl-6-(2-methyl-2-morpholin-4-ylpropanoyl)carbazol-3-yl]-2-oxoethylidene]amino] acetate |
|---|---|
| PubChem CID | 162463656 |
| Molecular Formula | C26H28ClN3O5 |
| Molecular Weight | 497.98 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | [(Z)-[1-chloro-2-[9-ethyl-6-(2-methyl-2-morpholin-4-ylpropanoyl)carbazol-3-yl]-2-oxoethylidene]amino] acetate |
| SMILES | CCn1c2ccc(C(=O)/C(Cl)=N/OC(C)=O)cc2c2cc(C(=O)C(C)(C)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C26H28ClN3O5/c1-5-30-21-8-6-17(23(32)25(27)28-35-16(2)31)14-19(21)20-15-18(7-9-22(20)30)24(33)26(3,4)29-10-12-34-13-11-29/h6-9,14-15H,5,10-13H2,1-4H3/b28-25- |
| InChIKey | KMNCMTLBEBWIGL-FVDSYPCUSA-N |
| XLogP | 4.41 |
| TPSA | 90.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.98 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|