C34H45N3O5S — CID 162463671
[(E)-[1-[9-ethyl-6-(2-methyl-2-morpholin-4-ylpropanoyl)carbazol-3-yl]-1-oxo-5-sulfanylpentan-2-ylidene]amino] heptanoate (PubChem CID 162463671) has the molecular formula C34H45N3O5S and a molecular weight of 607.82 g/mol. Its IUPAC name is [(E)-[1-[9-ethyl-6-(2-methyl-2-morpholin-4-ylpropanoyl)carbazol-3-yl]-1-oxo-5-sulfanylpentan-2-ylidene]amino] heptanoate.
| Compound Name | [(E)-[1-[9-ethyl-6-(2-methyl-2-morpholin-4-ylpropanoyl)carbazol-3-yl]-1-oxo-5-sulfanylpentan-2-ylidene]amino] heptanoate |
|---|---|
| PubChem CID | 162463671 |
| Molecular Formula | C34H45N3O5S |
| Molecular Weight | 607.82 g/mol |
| Exact Mass | 607.31 |
| IUPAC Name | [(E)-[1-[9-ethyl-6-(2-methyl-2-morpholin-4-ylpropanoyl)carbazol-3-yl]-1-oxo-5-sulfanylpentan-2-ylidene]amino] heptanoate |
| SMILES | CCCCCCC(=O)O/N=C(\CCCS)C(=O)c1ccc2c(c1)c1cc(C(=O)C(C)(C)N3CCOCC3)ccc1n2CC |
| InChI | InChI=1S/C34H45N3O5S/c1-5-7-8-9-12-31(38)42-35-28(11-10-21-43)32(39)24-13-15-29-26(22-24)27-23-25(14-16-30(27)37(29)6-2)33(40)34(3,4)36-17-19-41-20-18-36/h13-16,22-23,43H,5-12,17-21H2,1-4H3/b35-28+ |
| InChIKey | GCFTUBQMIRWFON-AWQADKOQSA-N |
| XLogP | 6.87 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.82 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|