C35H43N3O6 — CID 175369821
[[1-[6-(2-acetyloxyimino-3-cyclohexylpropanoyl)-9-ethylcarbazol-3-yl]-1-oxooctan-2-ylidene]amino] acetate (PubChem CID 175369821) has the molecular formula C35H43N3O6 and a molecular weight of 601.74 g/mol. Its IUPAC name is [[1-[6-(2-acetyloxyimino-3-cyclohexylpropanoyl)-9-ethylcarbazol-3-yl]-1-oxooctan-2-ylidene]amino] acetate.
| Compound Name | [[1-[6-(2-acetyloxyimino-3-cyclohexylpropanoyl)-9-ethylcarbazol-3-yl]-1-oxooctan-2-ylidene]amino] acetate |
|---|---|
| PubChem CID | 175369821 |
| Molecular Formula | C35H43N3O6 |
| Molecular Weight | 601.74 g/mol |
| Exact Mass | 601.32 |
| IUPAC Name | [[1-[6-(2-acetyloxyimino-3-cyclohexylpropanoyl)-9-ethylcarbazol-3-yl]-1-oxooctan-2-ylidene]amino] acetate |
| SMILES | CCCCCCC(=NOC(C)=O)C(=O)c1ccc2c(c1)c1cc(C(=O)C(CC3CCCCC3)=NOC(C)=O)ccc1n2CC |
| InChI | InChI=1S/C35H43N3O6/c1-5-7-8-12-15-30(36-43-23(3)39)34(41)26-16-18-32-28(21-26)29-22-27(17-19-33(29)38(32)6-2)35(42)31(37-44-24(4)40)20-25-13-10-9-11-14-25/h16-19,21-22,25H,5-15,20H2,1-4H3 |
| InChIKey | YPYFCFWYDTVDSE-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 116.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.74 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|